About 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one
6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one (PubChem CID 141403440) has the molecular formula C12H10BrNO
and a molecular weight of 264.12 g/mol. Its IUPAC name is 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one.
Molecular Properties
| Compound Name | 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one |
| PubChem CID | 141403440 |
| Molecular Formula | C12H10BrNO |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one |
| SMILES | O=C1CCCC2=Nc3ccc(Br)cc3C12 |
| InChI | InChI=1S/C12H10BrNO/c13-7-4-5-9-8(6-7)12-10(14-9)2-1-3-11(12)15/h4-6,12H,1-3H2 |
| InChIKey | MLNFOCDAPLVKHQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one?
The IUPAC name of 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one (CID 141403440) is 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one.
What is the SMILES notation for 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one?
The canonical SMILES for 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one is O=C1CCCC2=Nc3ccc(Br)cc3C12.
What is the InChIKey of 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one?
The InChIKey is MLNFOCDAPLVKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO/c13-7-4-5-9-8(6-7)12-10(14-9)2-1-3-11(12)15/h4-6,12H,1-3H2.
What are the key properties of 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one?
6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one has a molecular weight of 264.12 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,2,3,4a-tetrahydrocarbazol-4-one is sourced from PubChem (CID 141403440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).