C9H7Cl2N5S — CID 14140362
2-[5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14140362) has the molecular formula C9H7Cl2N5S and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-[5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
| Compound Name | 2-[5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 14140362 |
| Molecular Formula | C9H7Cl2N5S |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 2-[5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nnc(-c2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C9H7Cl2N5S/c10-4-2-1-3-5(11)6(4)7-15-16-9(17-7)14-8(12)13/h1-3H,(H4,12,13,14,16) |
| InChIKey | LSDAKTGOKVYYGS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|