About 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine
2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14140375) has the molecular formula C9H10N6S
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| PubChem CID | 14140375 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nnc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C9H10N6S/c10-6-4-2-1-3-5(6)7-14-15-9(16-7)13-8(11)12/h1-4H,10H2,(H4,11,12,13,15) |
| InChIKey | BFSVTMVZYWLDIF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The IUPAC name of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine (CID 14140375) is 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine.
What is the SMILES notation for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The canonical SMILES for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine is NC(N)=Nc1nnc(-c2ccccc2N)s1.
What is the InChIKey of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
The InChIKey is BFSVTMVZYWLDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6S/c10-6-4-2-1-3-5(6)7-14-15-9(16-7)13-8(11)12/h1-4H,10H2,(H4,11,12,13,15).
What are the key properties of 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine?
2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine has a molecular weight of 234.29 g/mol, XLogP of 0.69, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]guanidine is sourced from PubChem (CID 14140375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).