C14H18N6OS — CID 14140431
N-[2-[[amino-[[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]methylidene]amino]ethyl]acetamide (PubChem CID 14140431) has the molecular formula C14H18N6OS and a molecular weight of 318.41 g/mol. Its IUPAC name is N-[2-[[amino-[[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]methylidene]amino]ethyl]acetamide.
| Compound Name | N-[2-[[amino-[[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]methylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 14140431 |
| Molecular Formula | C14H18N6OS |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[2-[[amino-[[5-(2-methylphenyl)-1,3,4-thiadiazol-2-yl]amino]methylidene]amino]ethyl]acetamide |
| SMILES | CC(=O)NCC/N=C(\N)Nc1nnc(-c2ccccc2C)s1 |
| InChI | InChI=1S/C14H18N6OS/c1-9-5-3-4-6-11(9)12-19-20-14(22-12)18-13(15)17-8-7-16-10(2)21/h3-6H,7-8H2,1-2H3,(H,16,21)(H3,15,17,18,20) |
| InChIKey | WBVDCRTXFYFIGS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|