About (4-methyloxan-4-yl) carbamate
(4-methyloxan-4-yl) carbamate (PubChem CID 141404618) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is (4-methyloxan-4-yl) carbamate.
Molecular Properties
| Compound Name | (4-methyloxan-4-yl) carbamate |
| PubChem CID | 141404618 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (4-methyloxan-4-yl) carbamate |
| SMILES | CC1(OC(N)=O)CCOCC1 |
| InChI | InChI=1S/C7H13NO3/c1-7(11-6(8)9)2-4-10-5-3-7/h2-5H2,1H3,(H2,8,9) |
| InChIKey | KHLXWJQHZNUZSX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyloxan-4-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyloxan-4-yl) carbamate?
The IUPAC name of (4-methyloxan-4-yl) carbamate (CID 141404618) is (4-methyloxan-4-yl) carbamate.
What is the SMILES notation for (4-methyloxan-4-yl) carbamate?
The canonical SMILES for (4-methyloxan-4-yl) carbamate is CC1(OC(N)=O)CCOCC1.
What is the InChIKey of (4-methyloxan-4-yl) carbamate?
The InChIKey is KHLXWJQHZNUZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(11-6(8)9)2-4-10-5-3-7/h2-5H2,1H3,(H2,8,9).
What are the key properties of (4-methyloxan-4-yl) carbamate?
(4-methyloxan-4-yl) carbamate has a molecular weight of 159.18 g/mol, XLogP of 0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyloxan-4-yl) carbamate is sourced from PubChem (CID 141404618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).