About 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine
4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine (PubChem CID 141405167) has the molecular formula C16H23F2N3O
and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine.
Molecular Properties
| Compound Name | 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine |
| PubChem CID | 141405167 |
| Molecular Formula | C16H23F2N3O |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine |
| SMILES | FC1(F)CCC(n2nccc2C2CCN(C3COC3)CC2)C1 |
| InChI | InChI=1S/C16H23F2N3O/c17-16(18)5-1-13(9-16)21-15(2-6-19-21)12-3-7-20(8-4-12)14-10-22-11-14/h2,6,12-14H,1,3-5,7-11H2 |
| InChIKey | PUPFIOKSDQOUIC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine?
The IUPAC name of 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine (CID 141405167) is 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine.
What is the SMILES notation for 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine?
The canonical SMILES for 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine is FC1(F)CCC(n2nccc2C2CCN(C3COC3)CC2)C1.
What is the InChIKey of 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine?
The InChIKey is PUPFIOKSDQOUIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2N3O/c17-16(18)5-1-13(9-16)21-15(2-6-19-21)12-3-7-20(8-4-12)14-10-22-11-14/h2,6,12-14H,1,3-5,7-11H2.
What are the key properties of 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine?
4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine has a molecular weight of 311.38 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-difluorocyclopentyl)pyrazol-3-yl]-1-(oxetan-3-yl)piperidine is sourced from PubChem (CID 141405167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).