About 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide
2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide (PubChem CID 14140517) has the molecular formula C21H14F3N3O2S
and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| PubChem CID | 14140517 |
| Molecular Formula | C21H14F3N3O2S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1nccs1)c1c(Cc2ccccc2)[nH]c2c(C(F)(F)F)cccc2c1=O |
| InChI | InChI=1S/C21H14F3N3O2S/c22-21(23,24)14-8-4-7-13-17(14)26-15(11-12-5-2-1-3-6-12)16(18(13)28)19(29)27-20-25-9-10-30-20/h1-10H,11H2,(H,26,28)(H,25,27,29) |
| InChIKey | MASNHTPQFZPOJP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The IUPAC name of 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide (CID 14140517) is 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide.
What is the SMILES notation for 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The canonical SMILES for 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide is O=C(Nc1nccs1)c1c(Cc2ccccc2)[nH]c2c(C(F)(F)F)cccc2c1=O.
What is the InChIKey of 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The InChIKey is MASNHTPQFZPOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3N3O2S/c22-21(23,24)14-8-4-7-13-17(14)26-15(11-12-5-2-1-3-6-12)16(18(13)28)19(29)27-20-25-9-10-30-20/h1-10H,11H2,(H,26,28)(H,25,27,29).
What are the key properties of 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide has a molecular weight of 429.42 g/mol, XLogP of 4.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-oxo-N-(1,3-thiazol-2-yl)-8-(trifluoromethyl)-1H-quinoline-3-carboxamide is sourced from PubChem (CID 14140517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).