About 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide
6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide (PubChem CID 14140521) has the molecular formula C15H10F3N3O3S
and a molecular weight of 369.32 g/mol. Its IUPAC name is 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| PubChem CID | 14140521 |
| Molecular Formula | C15H10F3N3O3S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc2[nH]c(C(F)(F)F)c(C(=O)Nc3nccs3)c(=O)c2c1 |
| InChI | InChI=1S/C15H10F3N3O3S/c1-24-7-2-3-9-8(6-7)11(22)10(12(20-9)15(16,17)18)13(23)21-14-19-4-5-25-14/h2-6H,1H3,(H,20,22)(H,19,21,23) |
| InChIKey | ULFFWOLUINVVIA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The IUPAC name of 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide (CID 14140521) is 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide.
What is the SMILES notation for 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The canonical SMILES for 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide is COc1ccc2[nH]c(C(F)(F)F)c(C(=O)Nc3nccs3)c(=O)c2c1.
What is the InChIKey of 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The InChIKey is ULFFWOLUINVVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O3S/c1-24-7-2-3-9-8(6-7)11(22)10(12(20-9)15(16,17)18)13(23)21-14-19-4-5-25-14/h2-6H,1H3,(H,20,22)(H,19,21,23).
What are the key properties of 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide?
6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide has a molecular weight of 369.32 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-oxo-N-(1,3-thiazol-2-yl)-2-(trifluoromethyl)-1H-quinoline-3-carboxamide is sourced from PubChem (CID 14140521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).