About 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide
2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide (PubChem CID 14140548) has the molecular formula C16H12F3N3O3
and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| PubChem CID | 14140548 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| SMILES | CCc1[nH]c2c(C(F)(F)F)cccc2c(=O)c1C(=O)Nc1ncco1 |
| InChI | InChI=1S/C16H12F3N3O3/c1-2-10-11(14(24)22-15-20-6-7-25-15)13(23)8-4-3-5-9(12(8)21-10)16(17,18)19/h3-7H,2H2,1H3,(H,21,23)(H,20,22,24) |
| InChIKey | FYGFNJICGHSJIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The IUPAC name of 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide (CID 14140548) is 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide.
What is the SMILES notation for 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The canonical SMILES for 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide is CCc1[nH]c2c(C(F)(F)F)cccc2c(=O)c1C(=O)Nc1ncco1.
What is the InChIKey of 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
The InChIKey is FYGFNJICGHSJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3N3O3/c1-2-10-11(14(24)22-15-20-6-7-25-15)13(23)8-4-3-5-9(12(8)21-10)16(17,18)19/h3-7H,2H2,1H3,(H,21,23)(H,20,22,24).
What are the key properties of 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide?
2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide has a molecular weight of 351.28 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(1,3-oxazol-2-yl)-4-oxo-8-(trifluoromethyl)-1H-quinoline-3-carboxamide is sourced from PubChem (CID 14140548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).