About 1-(3-methylpentyl)-2,5-dihydroindigole
1-(3-methylpentyl)-2,5-dihydroindigole (PubChem CID 141405726) has the molecular formula C10H19In
and a molecular weight of 254.08 g/mol. Its IUPAC name is 1-(3-methylpentyl)-2,5-dihydroindigole.
Molecular Properties
| Compound Name | 1-(3-methylpentyl)-2,5-dihydroindigole |
| PubChem CID | 141405726 |
| Molecular Formula | C10H19In |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-(3-methylpentyl)-2,5-dihydroindigole |
| SMILES | CCC(C)CC[In]1CC=CC1 |
| InChI | InChI=1S/C6H13.C4H6.In/c1-4-6(3)5-2;1-3-4-2;/h6H,1,4-5H2,2-3H3;3-4H,1-2H2;/b;4-3-; |
| InChIKey | CKTIPQCJCWTRPX-LWFKIUJUSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylpentyl)-2,5-dihydroindigole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylpentyl)-2,5-dihydroindigole?
The IUPAC name of 1-(3-methylpentyl)-2,5-dihydroindigole (CID 141405726) is 1-(3-methylpentyl)-2,5-dihydroindigole.
What is the SMILES notation for 1-(3-methylpentyl)-2,5-dihydroindigole?
The canonical SMILES for 1-(3-methylpentyl)-2,5-dihydroindigole is CCC(C)CC[In]1CC=CC1.
What is the InChIKey of 1-(3-methylpentyl)-2,5-dihydroindigole?
The InChIKey is CKTIPQCJCWTRPX-LWFKIUJUSA-N. The full InChI is InChI=1S/C6H13.C4H6.In/c1-4-6(3)5-2;1-3-4-2;/h6H,1,4-5H2,2-3H3;3-4H,1-2H2;/b;4-3-;.
What are the key properties of 1-(3-methylpentyl)-2,5-dihydroindigole?
1-(3-methylpentyl)-2,5-dihydroindigole has a molecular weight of 254.08 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylpentyl)-2,5-dihydroindigole is sourced from PubChem (CID 141405726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).