C14H16N2O3 — CID 141405752
(4aS,7aR)-6-benzyl-1-oxido-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-1-ium-5,7-dione (PubChem CID 141405752) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4aS,7aR)-6-benzyl-1-oxido-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-1-ium-5,7-dione.
| Compound Name | (4aS,7aR)-6-benzyl-1-oxido-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-1-ium-5,7-dione |
|---|---|
| PubChem CID | 141405752 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4aS,7aR)-6-benzyl-1-oxido-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-1-ium-5,7-dione |
| SMILES | O=C1[C@H]2CCC[NH+]([O-])[C@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H16N2O3/c17-13-11-7-4-8-16(19)12(11)14(18)15(13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12,16H,4,7-9H2/t11-,12+/m0/s1 |
| InChIKey | GMNKYVTXZKWVEZ-NWDGAFQWSA-N |
| XLogP | -0.28 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|