About 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide
3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide (PubChem CID 141406199) has the molecular formula C9H10BrNO2S2
and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide.
Molecular Properties
| Compound Name | 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide |
| PubChem CID | 141406199 |
| Molecular Formula | C9H10BrNO2S2 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide |
| SMILES | CCN1CSc2cc(S(=O)(=O)Br)ccc21 |
| InChI | InChI=1S/C9H10BrNO2S2/c1-2-11-6-14-9-5-7(15(10,12)13)3-4-8(9)11/h3-5H,2,6H2,1H3 |
| InChIKey | INJVHUVNGWIQGG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide?
The IUPAC name of 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide (CID 141406199) is 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide.
What is the SMILES notation for 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide?
The canonical SMILES for 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide is CCN1CSc2cc(S(=O)(=O)Br)ccc21.
What is the InChIKey of 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide?
The InChIKey is INJVHUVNGWIQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2S2/c1-2-11-6-14-9-5-7(15(10,12)13)3-4-8(9)11/h3-5H,2,6H2,1H3.
What are the key properties of 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide?
3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide has a molecular weight of 308.22 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-1,3-benzothiazole-6-sulfonyl bromide is sourced from PubChem (CID 141406199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).