About (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene
(1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene (PubChem CID 141406449) has the molecular formula C25H26O
and a molecular weight of 342.48 g/mol. Its IUPAC name is (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene |
| PubChem CID | 141406449 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene |
| SMILES | CC(C)Cc1ccc(-c2cccc3c2CC[C@H]3Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O/c1-18(2)17-19-11-13-20(14-12-19)22-9-6-10-24-23(22)15-16-25(24)26-21-7-4-3-5-8-21/h3-14,18,25H,15-17H2,1-2H3/t25-/m1/s1 |
| InChIKey | NZWXUQSJMAVRMX-RUZDIDTESA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene?
The IUPAC name of (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene (CID 141406449) is (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene?
The canonical SMILES for (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene is CC(C)Cc1ccc(-c2cccc3c2CC[C@H]3Oc2ccccc2)cc1.
What is the InChIKey of (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene?
The InChIKey is NZWXUQSJMAVRMX-RUZDIDTESA-N. The full InChI is InChI=1S/C25H26O/c1-18(2)17-19-11-13-20(14-12-19)22-9-6-10-24-23(22)15-16-25(24)26-21-7-4-3-5-8-21/h3-14,18,25H,15-17H2,1-2H3/t25-/m1/s1.
What are the key properties of (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene?
(1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene has a molecular weight of 342.48 g/mol, XLogP of 6.62, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-[4-(2-methylpropyl)phenyl]-1-phenoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 141406449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).