About 1-nitro-3,6-dihydro-2H-pyridine
1-nitro-3,6-dihydro-2H-pyridine (PubChem CID 141406660) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-nitro-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-nitro-3,6-dihydro-2H-pyridine |
| PubChem CID | 141406660 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1-nitro-3,6-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])N1CC=CCC1 |
| InChI | InChI=1S/C5H8N2O2/c8-7(9)6-4-2-1-3-5-6/h1-2H,3-5H2 |
| InChIKey | FOEAMYJWWUPTRT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-nitro-3,6-dihydro-2H-pyridine (CID 141406660) is 1-nitro-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-nitro-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-nitro-3,6-dihydro-2H-pyridine is O=[N+]([O-])N1CC=CCC1.
What is the InChIKey of 1-nitro-3,6-dihydro-2H-pyridine?
The InChIKey is FOEAMYJWWUPTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c8-7(9)6-4-2-1-3-5-6/h1-2H,3-5H2.
What are the key properties of 1-nitro-3,6-dihydro-2H-pyridine?
1-nitro-3,6-dihydro-2H-pyridine has a molecular weight of 128.13 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 141406660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).