C40H30N4O9 — CID 141406920
5-amino-2-[2-(4-amino-2-carboxyphenyl)-3-[2,3-bis(4-amino-2-carboxyphenyl)phenoxy]phenyl]benzoic acid (PubChem CID 141406920) has the molecular formula C40H30N4O9 and a molecular weight of 710.70 g/mol. Its IUPAC name is 5-amino-2-[2-(4-amino-2-carboxyphenyl)-3-[2,3-bis(4-amino-2-carboxyphenyl)phenoxy]phenyl]benzoic acid.
| Compound Name | 5-amino-2-[2-(4-amino-2-carboxyphenyl)-3-[2,3-bis(4-amino-2-carboxyphenyl)phenoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 141406920 |
| Molecular Formula | C40H30N4O9 |
| Molecular Weight | 710.70 g/mol |
| Exact Mass | 710.20 |
| IUPAC Name | 5-amino-2-[2-(4-amino-2-carboxyphenyl)-3-[2,3-bis(4-amino-2-carboxyphenyl)phenoxy]phenyl]benzoic acid |
| SMILES | Nc1ccc(-c2cccc(Oc3cccc(-c4ccc(N)cc4C(=O)O)c3-c3ccc(N)cc3C(=O)O)c2-c2ccc(N)cc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C40H30N4O9/c41-19-7-11-23(29(15-19)37(45)46)25-3-1-5-33(35(25)27-13-9-21(43)17-31(27)39(49)50)53-34-6-2-4-26(24-12-8-20(42)16-30(24)38(47)48)36(34)28-14-10-22(44)18-32(28)40(51)52/h1-18H,41-44H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | DPEPTMNGLHSORG-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 262.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|