C12H20F2N2O2 — CID 141407053
2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]heptane-1,3-diol (PubChem CID 141407053) has the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]heptane-1,3-diol.
| Compound Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]heptane-1,3-diol |
|---|---|
| PubChem CID | 141407053 |
| Molecular Formula | C12H20F2N2O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]heptane-1,3-diol |
| SMILES | CCCCC(O)C(CO)c1cn(C)nc1C(F)F |
| InChI | InChI=1S/C12H20F2N2O2/c1-3-4-5-10(18)9(7-17)8-6-16(2)15-11(8)12(13)14/h6,9-10,12,17-18H,3-5,7H2,1-2H3 |
| InChIKey | AANNCSQHGMVCDG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |