C10H16F2N2O2 — CID 141407055
2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pentane-1,3-diol (PubChem CID 141407055) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pentane-1,3-diol.
| Compound Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pentane-1,3-diol |
|---|---|
| PubChem CID | 141407055 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pentane-1,3-diol |
| SMILES | CCC(O)C(CO)c1cn(C)nc1C(F)F |
| InChI | InChI=1S/C10H16F2N2O2/c1-3-8(16)7(5-15)6-4-14(2)13-9(6)10(11)12/h4,7-8,10,15-16H,3,5H2,1-2H3 |
| InChIKey | JIGCMJACEWRVLM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |