C11H18F2N2O2 — CID 141407057
2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]hexane-1,3-diol (PubChem CID 141407057) has the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]hexane-1,3-diol.
| Compound Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]hexane-1,3-diol |
|---|---|
| PubChem CID | 141407057 |
| Molecular Formula | C11H18F2N2O2 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]hexane-1,3-diol |
| SMILES | CCCC(O)C(CO)c1cn(C)nc1C(F)F |
| InChI | InChI=1S/C11H18F2N2O2/c1-3-4-9(17)8(6-16)7-5-15(2)14-10(7)11(12)13/h5,8-9,11,16-17H,3-4,6H2,1-2H3 |
| InChIKey | HTQHOCQAXYBQRB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |