C19H26N6O4 — CID 141407264
4-[4-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]butanoylamino]piperidine-1-carboxylic acid (PubChem CID 141407264) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-[4-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]butanoylamino]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]butanoylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141407264 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-[4-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]butanoylamino]piperidine-1-carboxylic acid |
| SMILES | COc1ccc(Cn2nnnc2CCCC(=O)NC2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H26N6O4/c1-29-16-7-5-14(6-8-16)13-25-17(21-22-23-25)3-2-4-18(26)20-15-9-11-24(12-10-15)19(27)28/h5-8,15H,2-4,9-13H2,1H3,(H,20,26)(H,27,28) |
| InChIKey | HSPDJQCRXZHPSO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |