C30H60O4 — CID 141407378
2-(2-hydroxyethoxy)ethyl 2,2-dioctyldecanoate (PubChem CID 141407378) has the molecular formula C30H60O4 and a molecular weight of 484.81 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2,2-dioctyldecanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2,2-dioctyldecanoate |
|---|---|
| PubChem CID | 141407378 |
| Molecular Formula | C30H60O4 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.45 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2,2-dioctyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)(CCCCCCCC)C(=O)OCCOCCO |
| InChI | InChI=1S/C30H60O4/c1-4-7-10-13-16-19-22-30(23-20-17-14-11-8-5-2,24-21-18-15-12-9-6-3)29(32)34-28-27-33-26-25-31/h31H,4-28H2,1-3H3 |
| InChIKey | PCNQIVNGQQFLSZ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|