C16H18F3N3O — CID 141407429
(2S)-1,2-dimethyl-8-[(3,4,5-trifluorophenyl)methoxy]-2,3,4,6-tetrahydropyrimido[1,2-c]pyrimidine (PubChem CID 141407429) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-8-[(3,4,5-trifluorophenyl)methoxy]-2,3,4,6-tetrahydropyrimido[1,2-c]pyrimidine.
| Compound Name | (2S)-1,2-dimethyl-8-[(3,4,5-trifluorophenyl)methoxy]-2,3,4,6-tetrahydropyrimido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 141407429 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (2S)-1,2-dimethyl-8-[(3,4,5-trifluorophenyl)methoxy]-2,3,4,6-tetrahydropyrimido[1,2-c]pyrimidine |
| SMILES | C[C@H]1CCN2CN=C(OCc3cc(F)c(F)c(F)c3)C=C2N1C |
| InChI | InChI=1S/C16H18F3N3O/c1-10-3-4-22-9-20-14(7-15(22)21(10)2)23-8-11-5-12(17)16(19)13(18)6-11/h5-7,10H,3-4,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | KAGRIYFLMIIITM-JTQLQIEISA-N |
| XLogP | 2.86 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|