About 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane
2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane (PubChem CID 14140927) has the molecular formula C5H4F6O2
and a molecular weight of 210.07 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane |
| PubChem CID | 14140927 |
| Molecular Formula | C5H4F6O2 |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)COC1(C(F)(F)F)CO1 |
| InChI | InChI=1S/C5H4F6O2/c6-4(7,8)2-13-3(1-12-3)5(9,10)11/h1-2H2 |
| InChIKey | NSDLPXQTVGTHHF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane?
The IUPAC name of 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane (CID 14140927) is 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane.
What is the SMILES notation for 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane?
The canonical SMILES for 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane is FC(F)(F)COC1(C(F)(F)F)CO1.
What is the InChIKey of 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane?
The InChIKey is NSDLPXQTVGTHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F6O2/c6-4(7,8)2-13-3(1-12-3)5(9,10)11/h1-2H2.
What are the key properties of 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane?
2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane has a molecular weight of 210.07 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)oxirane is sourced from PubChem (CID 14140927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).