C9H4F8N4 — CID 141409287
5-(1,1,2,2,2-pentafluoroethyl)-3-pyrazol-1-yl-4-(trifluoromethyl)-1H-pyrazole (PubChem CID 141409287) has the molecular formula C9H4F8N4 and a molecular weight of 320.14 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-3-pyrazol-1-yl-4-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-pyrazol-1-yl-4-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 141409287 |
| Molecular Formula | C9H4F8N4 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-pyrazol-1-yl-4-(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)(F)c1c(-n2cccn2)n[nH]c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F8N4/c10-7(11,9(15,16)17)5-4(8(12,13)14)6(20-19-5)21-3-1-2-18-21/h1-3H,(H,19,20) |
| InChIKey | RJCZTKWUZSOZSL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|