About N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide
N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide (PubChem CID 141409295) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide |
| PubChem CID | 141409295 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide |
| SMILES | CC(C)(CO)CCCNC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C12H20N2O2/c1-12(2,9-15)5-3-6-14-11(16)10-4-7-13-8-10/h4,7-8,13,15H,3,5-6,9H2,1-2H3,(H,14,16) |
| InChIKey | MLSIRFXJKLQQLZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide?
The IUPAC name of N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide (CID 141409295) is N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide.
What is the SMILES notation for N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide?
The canonical SMILES for N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide is CC(C)(CO)CCCNC(=O)c1cc[nH]c1.
What is the InChIKey of N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide?
The InChIKey is MLSIRFXJKLQQLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-12(2,9-15)5-3-6-14-11(16)10-4-7-13-8-10/h4,7-8,13,15H,3,5-6,9H2,1-2H3,(H,14,16).
What are the key properties of N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide?
N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide has a molecular weight of 224.30 g/mol, XLogP of 1.54, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hydroxy-4,4-dimethylpentyl)-1H-pyrrole-3-carboxamide is sourced from PubChem (CID 141409295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).