C15H18N2O3S — CID 141409789
2-(2,4,5-trimethylphenyl)sulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 141409789) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-(2,4,5-trimethylphenyl)sulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | 2-(2,4,5-trimethylphenyl)sulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 141409789 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(2,4,5-trimethylphenyl)sulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2nc3c(o2)CNCC3)cc1C |
| InChI | InChI=1S/C15H18N2O3S/c1-9-6-11(3)14(7-10(9)2)21(18,19)15-17-12-4-5-16-8-13(12)20-15/h6-7,16H,4-5,8H2,1-3H3 |
| InChIKey | QKYDXEVPJJKYRX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |