C8H20N4 — CID 141409932
[2,3,4-tris(aminomethyl)cyclobutyl]methanamine (PubChem CID 141409932) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is [2,3,4-tris(aminomethyl)cyclobutyl]methanamine.
| Compound Name | [2,3,4-tris(aminomethyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 141409932 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | [2,3,4-tris(aminomethyl)cyclobutyl]methanamine |
| SMILES | NCC1C(CN)C(CN)C1CN |
| InChI | InChI=1S/C8H20N4/c9-1-5-6(2-10)8(4-12)7(5)3-11/h5-8H,1-4,9-12H2 |
| InChIKey | ZQOAIRGFZQHYAN-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |