About 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole
4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole (PubChem CID 141409985) has the molecular formula C16H13N5S2
and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole |
| PubChem CID | 141409985 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole |
| SMILES | Cc1cc(Sc2ncnc3nc[nH]c23)cc(C)c1-c1cscn1 |
| InChI | InChI=1S/C16H13N5S2/c1-9-3-11(4-10(2)13(9)12-5-22-8-21-12)23-16-14-15(18-6-17-14)19-7-20-16/h3-8H,1-2H3,(H,17,18,19,20) |
| InChIKey | IZAPBXQBUFSRAJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole?
The IUPAC name of 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole (CID 141409985) is 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole.
What is the SMILES notation for 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole?
The canonical SMILES for 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole is Cc1cc(Sc2ncnc3nc[nH]c23)cc(C)c1-c1cscn1.
What is the InChIKey of 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole?
The InChIKey is IZAPBXQBUFSRAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5S2/c1-9-3-11(4-10(2)13(9)12-5-22-8-21-12)23-16-14-15(18-6-17-14)19-7-20-16/h3-8H,1-2H3,(H,17,18,19,20).
What are the key properties of 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole?
4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole has a molecular weight of 339.45 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazole is sourced from PubChem (CID 141409985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).