C21H15F4N5O — CID 141410014
3-[2-fluoro-4-(2,3,5-trifluorophenoxy)phenyl]-1-[(3R)-pyrrolidin-3-yl]pyrazolo[3,4-d]pyrimidine (PubChem CID 141410014) has the molecular formula C21H15F4N5O and a molecular weight of 429.38 g/mol. Its IUPAC name is 3-[2-fluoro-4-(2,3,5-trifluorophenoxy)phenyl]-1-[(3R)-pyrrolidin-3-yl]pyrazolo[3,4-d]pyrimidine.
| Compound Name | 3-[2-fluoro-4-(2,3,5-trifluorophenoxy)phenyl]-1-[(3R)-pyrrolidin-3-yl]pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 141410014 |
| Molecular Formula | C21H15F4N5O |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-[2-fluoro-4-(2,3,5-trifluorophenoxy)phenyl]-1-[(3R)-pyrrolidin-3-yl]pyrazolo[3,4-d]pyrimidine |
| SMILES | Fc1cc(F)c(F)c(Oc2ccc(-c3nn([C@@H]4CCNC4)c4ncncc34)c(F)c2)c1 |
| InChI | InChI=1S/C21H15F4N5O/c22-11-5-17(24)19(25)18(6-11)31-13-1-2-14(16(23)7-13)20-15-9-27-10-28-21(15)30(29-20)12-3-4-26-8-12/h1-2,5-7,9-10,12,26H,3-4,8H2/t12-/m1/s1 |
| InChIKey | JNGPILFDVVJMGX-GFCCVEGCSA-N |
| XLogP | 4.38 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|