About 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid
3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid (PubChem CID 141411183) has the molecular formula C13H11F3N2O5S2
and a molecular weight of 396.37 g/mol. Its IUPAC name is 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid.
Molecular Properties
| Compound Name | 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid |
| PubChem CID | 141411183 |
| Molecular Formula | C13H11F3N2O5S2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid |
| SMILES | Cc1cnc(C(CC(=O)O)c2cncc(OS(=O)(=O)C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C13H11F3N2O5S2/c1-7-4-18-12(24-7)10(3-11(19)20)8-2-9(6-17-5-8)23-25(21,22)13(14,15)16/h2,4-6,10H,3H2,1H3,(H,19,20) |
| InChIKey | VZQYWJCNPZCGBM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid?
The IUPAC name of 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid (CID 141411183) is 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid.
What is the SMILES notation for 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid?
The canonical SMILES for 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid is Cc1cnc(C(CC(=O)O)c2cncc(OS(=O)(=O)C(F)(F)F)c2)s1.
What is the InChIKey of 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid?
The InChIKey is VZQYWJCNPZCGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O5S2/c1-7-4-18-12(24-7)10(3-11(19)20)8-2-9(6-17-5-8)23-25(21,22)13(14,15)16/h2,4-6,10H,3H2,1H3,(H,19,20).
What are the key properties of 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid?
3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid has a molecular weight of 396.37 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1,3-thiazol-2-yl)-3-[5-(trifluoromethylsulfonyloxy)-3-pyridinyl]propanoic acid is sourced from PubChem (CID 141411183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).