About (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole
(4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (PubChem CID 141411238) has the molecular formula C8H13N3O3S
and a molecular weight of 231.28 g/mol. Its IUPAC name is (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| PubChem CID | 141411238 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole |
| SMILES | COC[C@H]1NCc2c1cnn2S(C)(=O)=O |
| InChI | InChI=1S/C8H13N3O3S/c1-14-5-7-6-3-10-11(15(2,12)13)8(6)4-9-7/h3,7,9H,4-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | SGLKURONIAJCCL-SSDOTTSWSA-N |
| XLogP | -0.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The IUPAC name of (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole (CID 141411238) is (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole.
What is the SMILES notation for (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The canonical SMILES for (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole is COC[C@H]1NCc2c1cnn2S(C)(=O)=O.
What is the InChIKey of (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
The InChIKey is SGLKURONIAJCCL-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13N3O3S/c1-14-5-7-6-3-10-11(15(2,12)13)8(6)4-9-7/h3,7,9H,4-5H2,1-2H3/t7-/m1/s1.
What are the key properties of (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole?
(4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole has a molecular weight of 231.28 g/mol, XLogP of -0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(methoxymethyl)-1-methylsulfonyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 141411238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).