C17H21F2NO2 — CID 141411260
1-(2,5-difluorophenyl)hex-5-yn-3-yl N-tert-butylcarbamate (PubChem CID 141411260) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)hex-5-yn-3-yl N-tert-butylcarbamate.
| Compound Name | 1-(2,5-difluorophenyl)hex-5-yn-3-yl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 141411260 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(2,5-difluorophenyl)hex-5-yn-3-yl N-tert-butylcarbamate |
| SMILES | C#CCC(CCc1cc(F)ccc1F)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H21F2NO2/c1-5-6-14(22-16(21)20-17(2,3)4)9-7-12-11-13(18)8-10-15(12)19/h1,8,10-11,14H,6-7,9H2,2-4H3,(H,20,21) |
| InChIKey | PIZALZQVYKLJFF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|