About propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate
propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate (PubChem CID 141411386) has the molecular formula C19H30N2O4
and a molecular weight of 350.46 g/mol. Its IUPAC name is propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate |
| PubChem CID | 141411386 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)C)C(=O)NC(C)COc1ccccc1 |
| InChI | InChI=1S/C19H30N2O4/c1-13(2)11-17(21-19(23)25-14(3)4)18(22)20-15(5)12-24-16-9-7-6-8-10-16/h6-10,13-15,17H,11-12H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | QZPPONYPCTXGHU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate?
The IUPAC name of propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate (CID 141411386) is propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate.
What is the SMILES notation for propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate?
The canonical SMILES for propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate is CC(C)CC(NC(=O)OC(C)C)C(=O)NC(C)COc1ccccc1.
What is the InChIKey of propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate?
The InChIKey is QZPPONYPCTXGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O4/c1-13(2)11-17(21-19(23)25-14(3)4)18(22)20-15(5)12-24-16-9-7-6-8-10-16/h6-10,13-15,17H,11-12H2,1-5H3,(H,20,22)(H,21,23).
What are the key properties of propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate?
propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate has a molecular weight of 350.46 g/mol, XLogP of 3.12, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[4-methyl-1-oxo-1-(1-phenoxypropan-2-ylamino)pentan-2-yl]carbamate is sourced from PubChem (CID 141411386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).