C20H27NO4Si — CID 141411905
4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-pyridinyl]benzoic acid (PubChem CID 141411905) has the molecular formula C20H27NO4Si and a molecular weight of 373.53 g/mol. Its IUPAC name is 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-pyridinyl]benzoic acid.
| Compound Name | 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 141411905 |
| Molecular Formula | C20H27NO4Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-pyridinyl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1ccc(-c2ccc(C(=O)O)cc2)cc1=O |
| InChI | InChI=1S/C20H27NO4Si/c1-20(2,3)26(4,5)25-13-12-21-11-10-17(14-18(21)22)15-6-8-16(9-7-15)19(23)24/h6-11,14H,12-13H2,1-5H3,(H,23,24) |
| InChIKey | NUUFUKIFGQMVOG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|