About 1,2,3-trifluorobenzene-6-ide;zinc
1,2,3-trifluorobenzene-6-ide;zinc (PubChem CID 141412419) has the molecular formula C6H2F3Zn-
and a molecular weight of 196.47 g/mol. Its IUPAC name is 1,2,3-trifluorobenzene-6-ide;zinc.
Molecular Properties
| Compound Name | 1,2,3-trifluorobenzene-6-ide;zinc |
| PubChem CID | 141412419 |
| Molecular Formula | C6H2F3Zn- |
| Molecular Weight | 196.47 g/mol |
| Exact Mass | 194.94 |
| IUPAC Name | 1,2,3-trifluorobenzene-6-ide;zinc |
| SMILES | Fc1[c-]ccc(F)c1F.[Zn] |
| InChI | InChI=1S/C6H2F3.Zn/c7-4-2-1-3-5(8)6(4)9;/h1-2H;/q-1; |
| InChIKey | OXCHVTAAGDFSEM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trifluorobenzene-6-ide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trifluorobenzene-6-ide;zinc?
The IUPAC name of 1,2,3-trifluorobenzene-6-ide;zinc (CID 141412419) is 1,2,3-trifluorobenzene-6-ide;zinc.
What is the SMILES notation for 1,2,3-trifluorobenzene-6-ide;zinc?
The canonical SMILES for 1,2,3-trifluorobenzene-6-ide;zinc is Fc1[c-]ccc(F)c1F.[Zn].
What is the InChIKey of 1,2,3-trifluorobenzene-6-ide;zinc?
The InChIKey is OXCHVTAAGDFSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F3.Zn/c7-4-2-1-3-5(8)6(4)9;/h1-2H;/q-1;.
What are the key properties of 1,2,3-trifluorobenzene-6-ide;zinc?
1,2,3-trifluorobenzene-6-ide;zinc has a molecular weight of 196.47 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trifluorobenzene-6-ide;zinc is sourced from PubChem (CID 141412419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).