C28H39N3O2S — CID 141412752
[2-[1-(4-butylphenyl)piperidin-4-yl]-1,3-thiazol-4-yl]-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone (PubChem CID 141412752) has the molecular formula C28H39N3O2S and a molecular weight of 481.71 g/mol. Its IUPAC name is [2-[1-(4-butylphenyl)piperidin-4-yl]-1,3-thiazol-4-yl]-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone.
| Compound Name | [2-[1-(4-butylphenyl)piperidin-4-yl]-1,3-thiazol-4-yl]-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 141412752 |
| Molecular Formula | C28H39N3O2S |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | [2-[1-(4-butylphenyl)piperidin-4-yl]-1,3-thiazol-4-yl]-(4-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
| SMILES | CCCCc1ccc(N2CCC(c3nc(C(=O)N4CCC(O)C5CCCCC54)cs3)CC2)cc1 |
| InChI | InChI=1S/C28H39N3O2S/c1-2-3-6-20-9-11-22(12-10-20)30-16-13-21(14-17-30)27-29-24(19-34-27)28(33)31-18-15-26(32)23-7-4-5-8-25(23)31/h9-12,19,21,23,25-26,32H,2-8,13-18H2,1H3 |
| InChIKey | QZCBADJDSUXMLF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|