C18H18N6O3 — CID 141412824
ethyl 3-[[3-(3,8-dimethylquinoxalin-2-yl)-1,2,6-triazabicyclo[3.1.0]hexa-2,4-dien-6-yl]amino]-3-oxopropanoate (PubChem CID 141412824) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 3-[[3-(3,8-dimethylquinoxalin-2-yl)-1,2,6-triazabicyclo[3.1.0]hexa-2,4-dien-6-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[3-(3,8-dimethylquinoxalin-2-yl)-1,2,6-triazabicyclo[3.1.0]hexa-2,4-dien-6-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 141412824 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 3-[[3-(3,8-dimethylquinoxalin-2-yl)-1,2,6-triazabicyclo[3.1.0]hexa-2,4-dien-6-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NN1c2cc(-c3nc4c(C)cccc4nc3C)nn21 |
| InChI | InChI=1S/C18H18N6O3/c1-4-27-16(26)9-14(25)22-24-15-8-13(21-23(15)24)18-11(3)19-12-7-5-6-10(2)17(12)20-18/h5-8H,4,9H2,1-3H3,(H,22,25) |
| InChIKey | SJURHMJGOFSJLK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|