About (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane
(1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane (PubChem CID 141415091) has the molecular formula C14H25P
and a molecular weight of 224.33 g/mol. Its IUPAC name is (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane.
Molecular Properties
| Compound Name | (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane |
| PubChem CID | 141415091 |
| Molecular Formula | C14H25P |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane |
| SMILES | CCCP(CCC)C1(C)C=CC=CC1C |
| InChI | InChI=1S/C14H25P/c1-5-11-15(12-6-2)14(4)10-8-7-9-13(14)3/h7-10,13H,5-6,11-12H2,1-4H3 |
| InChIKey | SFHZJVFRKHXCTO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane?
The IUPAC name of (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane (CID 141415091) is (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane.
What is the SMILES notation for (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane?
The canonical SMILES for (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane is CCCP(CCC)C1(C)C=CC=CC1C.
What is the InChIKey of (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane?
The InChIKey is SFHZJVFRKHXCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25P/c1-5-11-15(12-6-2)14(4)10-8-7-9-13(14)3/h7-10,13H,5-6,11-12H2,1-4H3.
What are the key properties of (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane?
(1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane has a molecular weight of 224.33 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylcyclohexa-2,4-dien-1-yl)-dipropylphosphane is sourced from PubChem (CID 141415091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).