About (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one
(E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one (PubChem CID 141415130) has the molecular formula C11H13Cl2N3O2
and a molecular weight of 290.15 g/mol. Its IUPAC name is (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one |
| PubChem CID | 141415130 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one |
| SMILES | COCCC/C=C/C(=O)c1c(Cl)nc(N)nc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O2/c1-18-6-4-2-3-5-7(17)8-9(12)15-11(14)16-10(8)13/h3,5H,2,4,6H2,1H3,(H2,14,15,16)/b5-3+ |
| InChIKey | UTFFEHYLZGSHAO-HWKANZROSA-N |
| XLogP | 2.53 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one?
The IUPAC name of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one (CID 141415130) is (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one.
What is the SMILES notation for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one?
The canonical SMILES for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one is COCCC/C=C/C(=O)c1c(Cl)nc(N)nc1Cl.
What is the InChIKey of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one?
The InChIKey is UTFFEHYLZGSHAO-HWKANZROSA-N. The full InChI is InChI=1S/C11H13Cl2N3O2/c1-18-6-4-2-3-5-7(17)8-9(12)15-11(14)16-10(8)13/h3,5H,2,4,6H2,1H3,(H2,14,15,16)/b5-3+.
What are the key properties of (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one?
(E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one has a molecular weight of 290.15 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2-amino-4,6-dichloropyrimidin-5-yl)-6-methoxyhex-2-en-1-one is sourced from PubChem (CID 141415130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).