C20H25NO2 — CID 141415961
(5R)-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-en-6-ynyl]pyrrolidin-2-one (PubChem CID 141415961) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is (5R)-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-en-6-ynyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-en-6-ynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141415961 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (5R)-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-en-6-ynyl]pyrrolidin-2-one |
| SMILES | C[C@@H](CC#CCCc1ccccc1)[C@H](O)/C=C/[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C20H25NO2/c1-16(19(22)14-12-18-13-15-20(23)21-18)8-4-2-5-9-17-10-6-3-7-11-17/h3,6-7,10-12,14,16,18-19,22H,5,8-9,13,15H2,1H3,(H,21,23)/b14-12+/t16-,18-,19+/m0/s1 |
| InChIKey | LOFCEIATRXDYSO-ZMQJPSBBSA-N |
| XLogP | 2.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|