C21H37NO2 — CID 141415995
(E,3S,4S)-1-[(2R)-1-(7-hydroxyheptyl)pyrrolidin-2-yl]-4-methylnon-1-en-6-yn-3-ol (PubChem CID 141415995) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is (E,3S,4S)-1-[(2R)-1-(7-hydroxyheptyl)pyrrolidin-2-yl]-4-methylnon-1-en-6-yn-3-ol.
| Compound Name | (E,3S,4S)-1-[(2R)-1-(7-hydroxyheptyl)pyrrolidin-2-yl]-4-methylnon-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 141415995 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | (E,3S,4S)-1-[(2R)-1-(7-hydroxyheptyl)pyrrolidin-2-yl]-4-methylnon-1-en-6-yn-3-ol |
| SMILES | CCC#CC[C@H](C)[C@H](O)/C=C/[C@H]1CCCN1CCCCCCCO |
| InChI | InChI=1S/C21H37NO2/c1-3-4-8-12-19(2)21(24)15-14-20-13-11-17-22(20)16-9-6-5-7-10-18-23/h14-15,19-21,23-24H,3,5-7,9-13,16-18H2,1-2H3/b15-14+/t19-,20+,21+/m0/s1 |
| InChIKey | JIWCCCBHTBGCGY-NRSPHGDISA-N |
| XLogP | 3.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|