About [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate
[4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate (PubChem CID 141416214) has the molecular formula C24H27O4P
and a molecular weight of 410.45 g/mol. Its IUPAC name is [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate.
Molecular Properties
| Compound Name | [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate |
| PubChem CID | 141416214 |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate |
| SMILES | CC(C)c1ccc(-c2ccc(OP(=O)(O)Oc3ccccc3)cc2)cc1C(C)C |
| InChI | InChI=1S/C24H27O4P/c1-17(2)23-15-12-20(16-24(23)18(3)4)19-10-13-22(14-11-19)28-29(25,26)27-21-8-6-5-7-9-21/h5-18H,1-4H3,(H,25,26) |
| InChIKey | FPOBHSQPNONNOC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate?
The IUPAC name of [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate (CID 141416214) is [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate.
What is the SMILES notation for [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate?
The canonical SMILES for [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate is CC(C)c1ccc(-c2ccc(OP(=O)(O)Oc3ccccc3)cc2)cc1C(C)C.
What is the InChIKey of [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate?
The InChIKey is FPOBHSQPNONNOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27O4P/c1-17(2)23-15-12-20(16-24(23)18(3)4)19-10-13-22(14-11-19)28-29(25,26)27-21-8-6-5-7-9-21/h5-18H,1-4H3,(H,25,26).
What are the key properties of [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate?
[4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate has a molecular weight of 410.45 g/mol, XLogP of 7.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,4-di(propan-2-yl)phenyl]phenyl] phenyl hydrogen phosphate is sourced from PubChem (CID 141416214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).