C47H30N4 — CID 141416223
5-(9,10-Diphenylanthracen-2-yl)-2-(4-pyridin-3-ylphenyl)benzo[e]benzotriazole (PubChem CID 141416223) has the molecular formula C47H30N4 and a molecular weight of 650.80 g/mol. Its IUPAC name is 5-(9,10-diphenylanthracen-2-yl)-2-(4-pyridin-3-ylphenyl)benzo[e]benzotriazole.
| Compound Name | 5-(9,10-Diphenylanthracen-2-yl)-2-(4-pyridin-3-ylphenyl)benzo[e]benzotriazole |
|---|---|
| PubChem CID | 141416223 |
| Molecular Formula | C47H30N4 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 5-(9,10-diphenylanthracen-2-yl)-2-(4-pyridin-3-ylphenyl)benzo[e]benzotriazole |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5)C6=CC7=NN(N=C7C8=CC=CC=C86)C9=CC=C(C=C9)C1=CN=CC=C1 |
| InChI | InChI=1S/C47H30N4/c1-3-12-32(13-4-1)45-38-18-8-9-19-39(38)46(33-14-5-2-6-15-33)43-28-34(23-26-40(43)45)42-29-44-47(41-20-10-7-17-37(41)42)50-51(49-44)36-24-21-31(22-25-36)35-16-11-27-48-30-35/h1-30H |
| InChIKey | WAASNSBUZJGXON-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | 1120 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|