About 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine (PubChem CID 141416245) has the molecular formula C21H30ClN5O2
and a molecular weight of 419.96 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine.
Molecular Properties
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine |
| PubChem CID | 141416245 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine |
| SMILES | CN1CN(CCCOC2CCCCO2)C=C2C1=NC(N)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H30ClN5O2/c1-25-15-26(10-4-12-29-19-5-2-3-11-28-19)14-18-20(25)24-21(23)27(18)13-16-6-8-17(22)9-7-16/h6-9,14,19,21H,2-5,10-13,15,23H2,1H3 |
| InChIKey | CPAZPTPBVHUTIJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine?
The IUPAC name of 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine (CID 141416245) is 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine.
What is the SMILES notation for 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine?
The canonical SMILES for 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine is CN1CN(CCCOC2CCCCO2)C=C2C1=NC(N)N2Cc1ccc(Cl)cc1.
What is the InChIKey of 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine?
The InChIKey is CPAZPTPBVHUTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30ClN5O2/c1-25-15-26(10-4-12-29-19-5-2-3-11-28-19)14-18-20(25)24-21(23)27(18)13-16-6-8-17(22)9-7-16/h6-9,14,19,21H,2-5,10-13,15,23H2,1H3.
What are the key properties of 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine?
7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine has a molecular weight of 419.96 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-chlorophenyl)methyl]-3-methyl-1-[3-(oxan-2-yloxy)propyl]-2,8-dihydropurin-8-amine is sourced from PubChem (CID 141416245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).