About (5-aminonaphthalen-2-yl) formate
(5-aminonaphthalen-2-yl) formate (PubChem CID 141416751) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is (5-aminonaphthalen-2-yl) formate.
Molecular Properties
| Compound Name | (5-aminonaphthalen-2-yl) formate |
| PubChem CID | 141416751 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (5-aminonaphthalen-2-yl) formate |
| SMILES | Nc1cccc2cc(OC=O)ccc12 |
| InChI | InChI=1S/C11H9NO2/c12-11-3-1-2-8-6-9(14-7-13)4-5-10(8)11/h1-7H,12H2 |
| InChIKey | NIRBNFZABGRSPH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-aminonaphthalen-2-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminonaphthalen-2-yl) formate?
The IUPAC name of (5-aminonaphthalen-2-yl) formate (CID 141416751) is (5-aminonaphthalen-2-yl) formate.
What is the SMILES notation for (5-aminonaphthalen-2-yl) formate?
The canonical SMILES for (5-aminonaphthalen-2-yl) formate is Nc1cccc2cc(OC=O)ccc12.
What is the InChIKey of (5-aminonaphthalen-2-yl) formate?
The InChIKey is NIRBNFZABGRSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c12-11-3-1-2-8-6-9(14-7-13)4-5-10(8)11/h1-7H,12H2.
What are the key properties of (5-aminonaphthalen-2-yl) formate?
(5-aminonaphthalen-2-yl) formate has a molecular weight of 187.20 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminonaphthalen-2-yl) formate is sourced from PubChem (CID 141416751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).