C39H39FN2O2 — CID 141416976
ethyl 2,3-bis(dibenzylamino)-2-(4-fluorophenyl)propanoate (PubChem CID 141416976) has the molecular formula C39H39FN2O2 and a molecular weight of 586.75 g/mol. Its IUPAC name is ethyl 2,3-bis(dibenzylamino)-2-(4-fluorophenyl)propanoate.
| Compound Name | ethyl 2,3-bis(dibenzylamino)-2-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 141416976 |
| Molecular Formula | C39H39FN2O2 |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | ethyl 2,3-bis(dibenzylamino)-2-(4-fluorophenyl)propanoate |
| SMILES | CCOC(=O)C(CN(Cc1ccccc1)Cc1ccccc1)(c1ccc(F)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C39H39FN2O2/c1-2-44-38(43)39(36-23-25-37(40)26-24-36,42(29-34-19-11-5-12-20-34)30-35-21-13-6-14-22-35)31-41(27-32-15-7-3-8-16-32)28-33-17-9-4-10-18-33/h3-26H,2,27-31H2,1H3 |
| InChIKey | DMODTJWSHXYRRP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |