C12H22Si — CID 141416984
trimethyl-[(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)methyl]silane (PubChem CID 141416984) has the molecular formula C12H22Si and a molecular weight of 194.39 g/mol. Its IUPAC name is trimethyl-[(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)methyl]silane.
| Compound Name | trimethyl-[(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)methyl]silane |
|---|---|
| PubChem CID | 141416984 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | trimethyl-[(2,3,3-trimethylcyclopenta-1,4-dien-1-yl)methyl]silane |
| SMILES | CC1=C(C[Si](C)(C)C)C=CC1(C)C |
| InChI | InChI=1S/C12H22Si/c1-10-11(9-13(4,5)6)7-8-12(10,2)3/h7-8H,9H2,1-6H3 |
| InChIKey | MMHXTAAFGCCETF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|