C18H19N3O3 — CID 141417259
N-[(3S,4R)-4-(1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)oxolan-3-yl]prop-2-enamide (PubChem CID 141417259) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(3S,4R)-4-(1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-(1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 141417259 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[(3S,4R)-4-(1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1COC[C@@H]1N1CCn2c(cc3ccccc32)C1=O |
| InChI | InChI=1S/C18H19N3O3/c1-2-17(22)19-13-10-24-11-16(13)21-8-7-20-14-6-4-3-5-12(14)9-15(20)18(21)23/h2-6,9,13,16H,1,7-8,10-11H2,(H,19,22)/t13-,16+/m1/s1 |
| InChIKey | NULHCAJROHPJBT-CJNGLKHVSA-N |
| XLogP | 1.17 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|