C16H12F3N3O4S — CID 141417275
methyl 4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 141417275) has the molecular formula C16H12F3N3O4S and a molecular weight of 399.35 g/mol. Its IUPAC name is methyl 4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 141417275 |
| Molecular Formula | C16H12F3N3O4S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | methyl 4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-6-sulfonylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC(c2nc3cc(C(F)(F)F)cnc3n2C)=CC1=S(=O)=O |
| InChI | InChI=1S/C16H12F3N3O4S/c1-22-13(21-11-6-9(16(17,18)19)7-20-14(11)22)8-3-4-10(15(23)26-2)12(5-8)27(24)25/h3-7,10H,1-2H3 |
| InChIKey | HKKGQVVXGYAWBF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|