About 8H-phenanthro[9,10-d][1,3]dioxol-7-one
8H-phenanthro[9,10-d][1,3]dioxol-7-one (PubChem CID 141417456) has the molecular formula C15H10O3
and a molecular weight of 238.24 g/mol. Its IUPAC name is 8H-phenanthro[9,10-d][1,3]dioxol-7-one.
Molecular Properties
| Compound Name | 8H-phenanthro[9,10-d][1,3]dioxol-7-one |
| PubChem CID | 141417456 |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 8H-phenanthro[9,10-d][1,3]dioxol-7-one |
| SMILES | O=C1C=CC=c2c3c(c4c(c21)CC=CC=4)OCO3 |
| InChI | InChI=1S/C15H10O3/c16-12-7-3-6-11-13(12)9-4-1-2-5-10(9)14-15(11)18-8-17-14/h1-3,5-7H,4,8H2 |
| InChIKey | LUQNIQXWMBORJA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8H-phenanthro[9,10-d][1,3]dioxol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-phenanthro[9,10-d][1,3]dioxol-7-one?
The IUPAC name of 8H-phenanthro[9,10-d][1,3]dioxol-7-one (CID 141417456) is 8H-phenanthro[9,10-d][1,3]dioxol-7-one.
What is the SMILES notation for 8H-phenanthro[9,10-d][1,3]dioxol-7-one?
The canonical SMILES for 8H-phenanthro[9,10-d][1,3]dioxol-7-one is O=C1C=CC=c2c3c(c4c(c21)CC=CC=4)OCO3.
What is the InChIKey of 8H-phenanthro[9,10-d][1,3]dioxol-7-one?
The InChIKey is LUQNIQXWMBORJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O3/c16-12-7-3-6-11-13(12)9-4-1-2-5-10(9)14-15(11)18-8-17-14/h1-3,5-7H,4,8H2.
What are the key properties of 8H-phenanthro[9,10-d][1,3]dioxol-7-one?
8H-phenanthro[9,10-d][1,3]dioxol-7-one has a molecular weight of 238.24 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-phenanthro[9,10-d][1,3]dioxol-7-one is sourced from PubChem (CID 141417456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).