About 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide
2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 141417552) has the molecular formula C15H15N3O
and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide |
| PubChem CID | 141417552 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | NC(=O)N1c2ccccc2CCC1c1ccccn1 |
| InChI | InChI=1S/C15H15N3O/c16-15(19)18-13-7-2-1-5-11(13)8-9-14(18)12-6-3-4-10-17-12/h1-7,10,14H,8-9H2,(H2,16,19) |
| InChIKey | VTEIIITWAVNZHH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide?
The IUPAC name of 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide (CID 141417552) is 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide.
What is the SMILES notation for 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide?
The canonical SMILES for 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide is NC(=O)N1c2ccccc2CCC1c1ccccn1.
What is the InChIKey of 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide?
The InChIKey is VTEIIITWAVNZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c16-15(19)18-13-7-2-1-5-11(13)8-9-14(18)12-6-3-4-10-17-12/h1-7,10,14H,8-9H2,(H2,16,19).
What are the key properties of 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide?
2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide has a molecular weight of 253.31 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-3,4-dihydro-2H-quinoline-1-carboxamide is sourced from PubChem (CID 141417552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).